C23H31N3O3Si — CID 59343781
(3R,4R)-4-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxan-3-ol (PubChem CID 59343781) has the molecular formula C23H31N3O3Si and a molecular weight of 425.61 g/mol. Its IUPAC name is (3R,4R)-4-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxan-3-ol.
| Compound Name | (3R,4R)-4-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxan-3-ol |
|---|---|
| PubChem CID | 59343781 |
| Molecular Formula | C23H31N3O3Si |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | (3R,4R)-4-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxan-3-ol |
| SMILES | CC1COC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](O)[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C23H31N3O3Si/c1-17-15-28-20(22(27)21(17)25-26-24)16-29-30(23(2,3)4,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,17,20-22,27H,15-16H2,1-4H3/t17?,20?,21-,22+/m1/s1 |
| InChIKey | ZNSMPVXXOGDZDF-CDMHEIPLSA-N |
| XLogP | 3.64 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|