C28H41N3O8Si — CID 139255092
(2S,3S,4S,5S,6R)-2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxane-3,4,5-triol (PubChem CID 139255092) has the molecular formula C28H41N3O8Si and a molecular weight of 575.73 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxane-3,4,5-triol.
| Compound Name | (2S,3S,4S,5S,6R)-2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 139255092 |
| Molecular Formula | C28H41N3O8Si |
| Molecular Weight | 575.73 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | (2S,3S,4S,5S,6R)-2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxane-3,4,5-triol |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@H](OCCOCCOCCN=[N+]=[N-])[C@@H](O)[C@@H](O)[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H41N3O8Si/c1-28(2,3)40(21-10-6-4-7-11-21,22-12-8-5-9-13-22)38-20-23-24(32)25(33)26(34)27(39-23)37-19-18-36-17-16-35-15-14-30-31-29/h4-13,23-27,32-34H,14-20H2,1-3H3/t23-,24-,25+,26+,27+/m1/s1 |
| InChIKey | MKJPCKTVDAPZSG-VKINHPFQSA-N |
| XLogP | 1.73 |
| TPSA | 155.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.73 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|