C25H36O4Si — CID 11339387
[(4R,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]methanol (PubChem CID 11339387) has the molecular formula C25H36O4Si and a molecular weight of 428.65 g/mol. Its IUPAC name is [(4R,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]methanol.
| Compound Name | [(4R,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]methanol |
|---|---|
| PubChem CID | 11339387 |
| Molecular Formula | C25H36O4Si |
| Molecular Weight | 428.65 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | [(4R,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]methanol |
| SMILES | CC1(C)O[C@@H](CO)C[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C25H36O4Si/c1-24(2,3)30(22-12-8-6-9-13-22,23-14-10-7-11-15-23)27-17-16-20-18-21(19-26)29-25(4,5)28-20/h6-15,20-21,26H,16-19H2,1-5H3/t20-,21+/m0/s1 |
| InChIKey | PFLCUOYBCYJBHF-LEWJYISDSA-N |
| XLogP | 3.86 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.65 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|