C27H38O4Si — CID 11134205
tert-butyl-[[(2S,5R,6S)-5-methoxy-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy]-diphenylsilane (PubChem CID 11134205) has the molecular formula C27H38O4Si and a molecular weight of 454.68 g/mol. Its IUPAC name is tert-butyl-[[(2S,5R,6S)-5-methoxy-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S,5R,6S)-5-methoxy-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11134205 |
| Molecular Formula | C27H38O4Si |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | tert-butyl-[[(2S,5R,6S)-5-methoxy-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy]-diphenylsilane |
| SMILES | CO[C@@H]1CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@]12CCCCO2 |
| InChI | InChI=1S/C27H38O4Si/c1-26(2,3)32(23-13-7-5-8-14-23,24-15-9-6-10-16-24)30-21-22-17-18-25(28-4)27(31-22)19-11-12-20-29-27/h5-10,13-16,22,25H,11-12,17-21H2,1-4H3/t22-,25+,27-/m0/s1 |
| InChIKey | XYFRRLAPMLOXKY-RWUBSVTLSA-N |
| XLogP | 4.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|