C38H58O3Si — CID 10054152
tert-butyl-[(4R)-4-[(2S,3S,6R,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]pentoxy]-diphenylsilane (PubChem CID 10054152) has the molecular formula C38H58O3Si and a molecular weight of 590.97 g/mol. Its IUPAC name is tert-butyl-[(4R)-4-[(2S,3S,6R,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]pentoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(4R)-4-[(2S,3S,6R,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]pentoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10054152 |
| Molecular Formula | C38H58O3Si |
| Molecular Weight | 590.97 g/mol |
| Exact Mass | 590.42 |
| IUPAC Name | tert-butyl-[(4R)-4-[(2S,3S,6R,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]pentoxy]-diphenylsilane |
| SMILES | C=C[C@@H](C)CC[C@@H]1O[C@@]2(CC[C@H]1C)CC[C@H](C)[C@H]([C@H](C)CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O2 |
| InChI | InChI=1S/C38H58O3Si/c1-9-29(2)22-23-35-30(3)24-26-38(40-35)27-25-32(5)36(41-38)31(4)17-16-28-39-42(37(6,7)8,33-18-12-10-13-19-33)34-20-14-11-15-21-34/h9-15,18-21,29-32,35-36H,1,16-17,22-28H2,2-8H3/t29-,30-,31-,32+,35+,36+,38-/m1/s1 |
| InChIKey | FRHCJKYNDROTGV-PAYLTBBPSA-N |
| XLogP | 8.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.97 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|