C28H40O3Si — CID 10623532
tert-butyl-diphenyl-[(E)-5-[(4R,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]pent-2-enoxy]silane (PubChem CID 10623532) has the molecular formula C28H40O3Si and a molecular weight of 452.71 g/mol. Its IUPAC name is tert-butyl-diphenyl-[(E)-5-[(4R,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]pent-2-enoxy]silane.
| Compound Name | tert-butyl-diphenyl-[(E)-5-[(4R,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]pent-2-enoxy]silane |
|---|---|
| PubChem CID | 10623532 |
| Molecular Formula | C28H40O3Si |
| Molecular Weight | 452.71 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | tert-butyl-diphenyl-[(E)-5-[(4R,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]pent-2-enoxy]silane |
| SMILES | C[C@H]1COC(C)(C)O[C@@H]1CC/C=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H40O3Si/c1-23-22-29-28(5,6)31-26(23)20-14-9-15-21-30-32(27(2,3)4,24-16-10-7-11-17-24)25-18-12-8-13-19-25/h7-13,15-19,23,26H,14,20-22H2,1-6H3/b15-9+/t23-,26+/m0/s1 |
| InChIKey | XVBZMVPFGZDHPH-LFJIKATCSA-N |
| XLogP | 5.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.71 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|