C25H38O2Si — CID 91740901
2,4-dimethylpentan-3-yloxy-hexoxy-diphenylsilane (PubChem CID 91740901) has the molecular formula C25H38O2Si and a molecular weight of 398.66 g/mol. Its IUPAC name is 2,4-dimethylpentan-3-yloxy-hexoxy-diphenylsilane.
| Compound Name | 2,4-dimethylpentan-3-yloxy-hexoxy-diphenylsilane |
|---|---|
| PubChem CID | 91740901 |
| Molecular Formula | C25H38O2Si |
| Molecular Weight | 398.66 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 2,4-dimethylpentan-3-yloxy-hexoxy-diphenylsilane |
| SMILES | CCCCCCO[Si](OC(C(C)C)C(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H38O2Si/c1-6-7-8-15-20-26-28(23-16-11-9-12-17-23,24-18-13-10-14-19-24)27-25(21(2)3)22(4)5/h9-14,16-19,21-22,25H,6-8,15,20H2,1-5H3 |
| InChIKey | BXGIVAHYENIKCY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.66 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|