C21H28F2OSi — CID 176438012
Tert-butyl-(4,4-difluoro-2-methylbutoxy)-diphenylsilane (PubChem CID 176438012) has the molecular formula C21H28F2OSi and a molecular weight of 362.50 g/mol. Its IUPAC name is tert-butyl-(4,4-difluoro-2-methylbutoxy)-diphenylsilane.
| Compound Name | Tert-butyl-(4,4-difluoro-2-methylbutoxy)-diphenylsilane |
|---|---|
| PubChem CID | 176438012 |
| Molecular Formula | C21H28F2OSi |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | tert-butyl-(4,4-difluoro-2-methylbutoxy)-diphenylsilane |
| SMILES | CC(CC(F)F)CO[Si](C1=CC=CC=C1)(C2=CC=CC=C2)C(C)(C)C |
| InChI | InChI=1S/C21H28F2OSi/c1-17(15-20(22)23)16-24-25(21(2,3)4,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,17,20H,15-16H2,1-4H3 |
| InChIKey | GWAWRVRPFGTZLV-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 9.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | 364 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|