C29H43IO3Si — CID 10875681
tert-butyl-[(2S)-2-[(4R,5S,6R)-6-[(2R)-1-iodopropan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propoxy]-diphenylsilane (PubChem CID 10875681) has the molecular formula C29H43IO3Si and a molecular weight of 594.65 g/mol. Its IUPAC name is tert-butyl-[(2S)-2-[(4R,5S,6R)-6-[(2R)-1-iodopropan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2S)-2-[(4R,5S,6R)-6-[(2R)-1-iodopropan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10875681 |
| Molecular Formula | C29H43IO3Si |
| Molecular Weight | 594.65 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | tert-butyl-[(2S)-2-[(4R,5S,6R)-6-[(2R)-1-iodopropan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propoxy]-diphenylsilane |
| SMILES | C[C@@H]1[C@H]([C@@H](C)CI)OC(C)(C)O[C@@H]1[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H43IO3Si/c1-21(19-30)26-23(3)27(33-29(7,8)32-26)22(2)20-31-34(28(4,5)6,24-15-11-9-12-16-24)25-17-13-10-14-18-25/h9-18,21-23,26-27H,19-20H2,1-8H3/t21-,22-,23+,26-,27+/m0/s1 |
| InChIKey | WDVALYIFNULZQY-VPZBFSRCSA-N |
| XLogP | 6.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.65 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|