C30H44O3Si — CID 14683914
[(2R)-2-[(4R,5S,6S)-6-[(2S)-but-3-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propoxy]-tert-butyl-diphenylsilane (PubChem CID 14683914) has the molecular formula C30H44O3Si and a molecular weight of 480.77 g/mol. Its IUPAC name is [(2R)-2-[(4R,5S,6S)-6-[(2S)-but-3-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(2R)-2-[(4R,5S,6S)-6-[(2S)-but-3-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 14683914 |
| Molecular Formula | C30H44O3Si |
| Molecular Weight | 480.77 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | [(2R)-2-[(4R,5S,6S)-6-[(2S)-but-3-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propoxy]-tert-butyl-diphenylsilane |
| SMILES | C=C[C@H](C)[C@@H]1OC(C)(C)O[C@H]([C@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C30H44O3Si/c1-10-22(2)27-24(4)28(33-30(8,9)32-27)23(3)21-31-34(29(5,6)7,25-17-13-11-14-18-25)26-19-15-12-16-20-26/h10-20,22-24,27-28H,1,21H2,2-9H3/t22-,23+,24-,27-,28+/m0/s1 |
| InChIKey | SVTGABKUYLSLLR-KZEXJIRGSA-N |
| XLogP | 6.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.77 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|