C30H40O4Si — CID 11179397
tert-butyl-[2-[(2R,3R)-2-methyl-4,6,8-trioxadispiro[4.1.57.25]tetradec-11-en-3-yl]ethoxy]-diphenylsilane (PubChem CID 11179397) has the molecular formula C30H40O4Si and a molecular weight of 492.73 g/mol. Its IUPAC name is tert-butyl-[2-[(2R,3R)-2-methyl-4,6,8-trioxadispiro[4.1.57.25]tetradec-11-en-3-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[(2R,3R)-2-methyl-4,6,8-trioxadispiro[4.1.57.25]tetradec-11-en-3-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11179397 |
| Molecular Formula | C30H40O4Si |
| Molecular Weight | 492.73 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | tert-butyl-[2-[(2R,3R)-2-methyl-4,6,8-trioxadispiro[4.1.57.25]tetradec-11-en-3-yl]ethoxy]-diphenylsilane |
| SMILES | C[C@@H]1CC2(CCC3(C=CCCO3)O2)O[C@@H]1CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H40O4Si/c1-24-23-30(20-19-29(34-30)18-11-12-21-31-29)33-27(24)17-22-32-35(28(2,3)4,25-13-7-5-8-14-25)26-15-9-6-10-16-26/h5-11,13-16,18,24,27H,12,17,19-23H2,1-4H3/t24-,27-,29?,30?/m1/s1 |
| InChIKey | IKZQBXQISYIOFW-IVIAQFCDSA-N |
| XLogP | 5.56 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.73 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|