C30H42O5Si — CID 11511823
(Z,4R)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(1R,4S,6R)-6-(methoxymethoxy)-4-(methoxymethyl)cyclohex-2-en-1-yl]but-2-en-1-ol (PubChem CID 11511823) has the molecular formula C30H42O5Si and a molecular weight of 510.75 g/mol. Its IUPAC name is (Z,4R)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(1R,4S,6R)-6-(methoxymethoxy)-4-(methoxymethyl)cyclohex-2-en-1-yl]but-2-en-1-ol.
| Compound Name | (Z,4R)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(1R,4S,6R)-6-(methoxymethoxy)-4-(methoxymethyl)cyclohex-2-en-1-yl]but-2-en-1-ol |
|---|---|
| PubChem CID | 11511823 |
| Molecular Formula | C30H42O5Si |
| Molecular Weight | 510.75 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | (Z,4R)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(1R,4S,6R)-6-(methoxymethoxy)-4-(methoxymethyl)cyclohex-2-en-1-yl]but-2-en-1-ol |
| SMILES | COCO[C@@H]1C[C@H](COC)C=C[C@H]1[C@@H](/C=C\CO)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H42O5Si/c1-30(2,3)36(25-13-8-6-9-14-25,26-15-10-7-11-16-26)35-28(17-12-20-31)27-19-18-24(22-32-4)21-29(27)34-23-33-5/h6-19,24,27-29,31H,20-23H2,1-5H3/b17-12-/t24-,27+,28-,29-/m1/s1 |
| InChIKey | XILRSZAZBISPPA-SCOIHMEMSA-N |
| XLogP | 4.31 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.75 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|