C33H50O6Si — CID 11444508
(2R)-2-[(2S,5S,6R)-6-[(E)-5-[tert-butyl(diphenyl)silyl]oxy-3-methylpent-3-enyl]-5-(methoxymethoxy)-5-methyloxan-2-yl]propane-1,2-diol (PubChem CID 11444508) has the molecular formula C33H50O6Si and a molecular weight of 570.84 g/mol. Its IUPAC name is (2R)-2-[(2S,5S,6R)-6-[(E)-5-[tert-butyl(diphenyl)silyl]oxy-3-methylpent-3-enyl]-5-(methoxymethoxy)-5-methyloxan-2-yl]propane-1,2-diol.
| Compound Name | (2R)-2-[(2S,5S,6R)-6-[(E)-5-[tert-butyl(diphenyl)silyl]oxy-3-methylpent-3-enyl]-5-(methoxymethoxy)-5-methyloxan-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 11444508 |
| Molecular Formula | C33H50O6Si |
| Molecular Weight | 570.84 g/mol |
| Exact Mass | 570.34 |
| IUPAC Name | (2R)-2-[(2S,5S,6R)-6-[(E)-5-[tert-butyl(diphenyl)silyl]oxy-3-methylpent-3-enyl]-5-(methoxymethoxy)-5-methyloxan-2-yl]propane-1,2-diol |
| SMILES | COCO[C@@]1(C)CC[C@@H]([C@](C)(O)CO)O[C@@H]1CC/C(C)=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H50O6Si/c1-26(18-19-30-33(6,37-25-36-7)22-20-29(39-30)32(5,35)24-34)21-23-38-40(31(2,3)4,27-14-10-8-11-15-27)28-16-12-9-13-17-28/h8-17,21,29-30,34-35H,18-20,22-25H2,1-7H3/b26-21+/t29-,30+,32+,33-/m0/s1 |
| InChIKey | GLKFDNYUVARDQK-MFJMSCRQSA-N |
| XLogP | 4.96 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.84 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|