C30H44O5Si — CID 11203055
tert-butyl-[[(2R,3R,4S,6R)-4-methoxy-3-(methoxymethoxy)-5,5-dimethyl-6-prop-2-enyloxan-2-yl]methoxy]-diphenylsilane (PubChem CID 11203055) has the molecular formula C30H44O5Si and a molecular weight of 512.76 g/mol. Its IUPAC name is tert-butyl-[[(2R,3R,4S,6R)-4-methoxy-3-(methoxymethoxy)-5,5-dimethyl-6-prop-2-enyloxan-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2R,3R,4S,6R)-4-methoxy-3-(methoxymethoxy)-5,5-dimethyl-6-prop-2-enyloxan-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11203055 |
| Molecular Formula | C30H44O5Si |
| Molecular Weight | 512.76 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | tert-butyl-[[(2R,3R,4S,6R)-4-methoxy-3-(methoxymethoxy)-5,5-dimethyl-6-prop-2-enyloxan-2-yl]methoxy]-diphenylsilane |
| SMILES | C=CC[C@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](OCOC)[C@@H](OC)C1(C)C |
| InChI | InChI=1S/C30H44O5Si/c1-9-16-26-30(5,6)28(32-8)27(33-22-31-7)25(35-26)21-34-36(29(2,3)4,23-17-12-10-13-18-23)24-19-14-11-15-20-24/h9-15,17-20,25-28H,1,16,21-22H2,2-8H3/t25-,26-,27+,28-/m1/s1 |
| InChIKey | ZMOZANAIHRIPIH-ZZXHUEHTSA-N |
| XLogP | 4.94 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.76 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|