C31H46O3Si2 — CID 51002642
tert-butyl-diphenyl-[[(4R,5R,6S)-2,2,5-trimethyl-6-[(2S)-4-trimethylsilylbut-3-yn-2-yl]-1,3-dioxan-4-yl]methoxy]silane (PubChem CID 51002642) has the molecular formula C31H46O3Si2 and a molecular weight of 522.88 g/mol. Its IUPAC name is tert-butyl-diphenyl-[[(4R,5R,6S)-2,2,5-trimethyl-6-[(2S)-4-trimethylsilylbut-3-yn-2-yl]-1,3-dioxan-4-yl]methoxy]silane.
| Compound Name | tert-butyl-diphenyl-[[(4R,5R,6S)-2,2,5-trimethyl-6-[(2S)-4-trimethylsilylbut-3-yn-2-yl]-1,3-dioxan-4-yl]methoxy]silane |
|---|---|
| PubChem CID | 51002642 |
| Molecular Formula | C31H46O3Si2 |
| Molecular Weight | 522.88 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | tert-butyl-diphenyl-[[(4R,5R,6S)-2,2,5-trimethyl-6-[(2S)-4-trimethylsilylbut-3-yn-2-yl]-1,3-dioxan-4-yl]methoxy]silane |
| SMILES | C[C@@H]1[C@H]([C@@H](C)C#C[Si](C)(C)C)OC(C)(C)O[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H46O3Si2/c1-24(21-22-35(8,9)10)29-25(2)28(33-31(6,7)34-29)23-32-36(30(3,4)5,26-17-13-11-14-18-26)27-19-15-12-16-20-27/h11-20,24-25,28-29H,23H2,1-10H3/t24-,25-,28-,29-/m0/s1 |
| InChIKey | PQDVOUZYYDSXBL-NSIYGSDQSA-N |
| XLogP | 6.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.88 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|