C27H40O3Si — CID 10575128
(2R,3R,4S,5S,6S)-1-[tert-butyl(diphenyl)silyl]oxy-2,4,6-trimethyloct-7-ene-3,5-diol (PubChem CID 10575128) has the molecular formula C27H40O3Si and a molecular weight of 440.70 g/mol. Its IUPAC name is (2R,3R,4S,5S,6S)-1-[tert-butyl(diphenyl)silyl]oxy-2,4,6-trimethyloct-7-ene-3,5-diol.
| Compound Name | (2R,3R,4S,5S,6S)-1-[tert-butyl(diphenyl)silyl]oxy-2,4,6-trimethyloct-7-ene-3,5-diol |
|---|---|
| PubChem CID | 10575128 |
| Molecular Formula | C27H40O3Si |
| Molecular Weight | 440.70 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | (2R,3R,4S,5S,6S)-1-[tert-butyl(diphenyl)silyl]oxy-2,4,6-trimethyloct-7-ene-3,5-diol |
| SMILES | C=C[C@H](C)[C@H](O)[C@H](C)[C@H](O)[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H40O3Si/c1-8-20(2)25(28)22(4)26(29)21(3)19-30-31(27(5,6)7,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h8-18,20-22,25-26,28-29H,1,19H2,2-7H3/t20-,21+,22-,25-,26+/m0/s1 |
| InChIKey | LUFKCRQGKMPPMN-DKMBGYIKSA-N |
| XLogP | 4.38 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.70 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|