C31H51IO2Si2 — CID 23649853
tert-butyl-[(2S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodo-2-methyloctoxy]-diphenylsilane (PubChem CID 23649853) has the molecular formula C31H51IO2Si2 and a molecular weight of 638.82 g/mol. Its IUPAC name is tert-butyl-[(2S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodo-2-methyloctoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodo-2-methyloctoxy]-diphenylsilane |
|---|---|
| PubChem CID | 23649853 |
| Molecular Formula | C31H51IO2Si2 |
| Molecular Weight | 638.82 g/mol |
| Exact Mass | 638.25 |
| IUPAC Name | tert-butyl-[(2S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodo-2-methyloctoxy]-diphenylsilane |
| SMILES | C[C@@H](CC[C@H](CCCI)O[Si](C)(C)C(C)(C)C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H51IO2Si2/c1-26(22-23-27(17-16-24-32)34-35(8,9)30(2,3)4)25-33-36(31(5,6)7,28-18-12-10-13-19-28)29-20-14-11-15-21-29/h10-15,18-21,26-27H,16-17,22-25H2,1-9H3/t26-,27-/m0/s1 |
| InChIKey | MODWCEXEWIKQGT-SVBPBHIXSA-N |
| XLogP | 8.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.82 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|