C28H42O6SSi — CID 46198060
[(2R,3S,4S,5S,6S)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-6-methoxy-3,5-dimethyloxan-4-yl] methanesulfonate (PubChem CID 46198060) has the molecular formula C28H42O6SSi and a molecular weight of 534.79 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6S)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-6-methoxy-3,5-dimethyloxan-4-yl] methanesulfonate.
| Compound Name | [(2R,3S,4S,5S,6S)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-6-methoxy-3,5-dimethyloxan-4-yl] methanesulfonate |
|---|---|
| PubChem CID | 46198060 |
| Molecular Formula | C28H42O6SSi |
| Molecular Weight | 534.79 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | [(2R,3S,4S,5S,6S)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-6-methoxy-3,5-dimethyloxan-4-yl] methanesulfonate |
| SMILES | CO[C@H]1O[C@H]([C@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](C)[C@H](OS(C)(=O)=O)[C@@H]1C |
| InChI | InChI=1S/C28H42O6SSi/c1-20(25-21(2)26(34-35(8,29)30)22(3)27(31-7)33-25)19-32-36(28(4,5)6,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-18,20-22,25-27H,19H2,1-8H3/t20-,21+,22+,25-,26+,27+/m1/s1 |
| InChIKey | AUSUMBFIAQKFED-XSCZJILHSA-N |
| XLogP | 4.19 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.79 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|