C28H42O3Si — CID 134866514
tert-butyl-[(2S,4R)-4-[(4R)-2,2-dimethyl-1,3-dioxan-4-yl]-2-methylpentoxy]-diphenylsilane (PubChem CID 134866514) has the molecular formula C28H42O3Si and a molecular weight of 454.73 g/mol. Its IUPAC name is tert-butyl-[(2S,4R)-4-[(4R)-2,2-dimethyl-1,3-dioxan-4-yl]-2-methylpentoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2S,4R)-4-[(4R)-2,2-dimethyl-1,3-dioxan-4-yl]-2-methylpentoxy]-diphenylsilane |
|---|---|
| PubChem CID | 134866514 |
| Molecular Formula | C28H42O3Si |
| Molecular Weight | 454.73 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | tert-butyl-[(2S,4R)-4-[(4R)-2,2-dimethyl-1,3-dioxan-4-yl]-2-methylpentoxy]-diphenylsilane |
| SMILES | C[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@@H](C)[C@H]1CCOC(C)(C)O1 |
| InChI | InChI=1S/C28H42O3Si/c1-22(20-23(2)26-18-19-29-28(6,7)31-26)21-30-32(27(3,4)5,24-14-10-8-11-15-24)25-16-12-9-13-17-25/h8-17,22-23,26H,18-21H2,1-7H3/t22-,23+,26+/m0/s1 |
| InChIKey | FORICMBPOMCBNW-PPJWLVRDSA-N |
| XLogP | 5.77 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.73 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|