C28H40O5Si — CID 10874560
(2R,3S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methyloxan-3-ol (PubChem CID 10874560) has the molecular formula C28H40O5Si and a molecular weight of 484.71 g/mol. Its IUPAC name is (2R,3S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methyloxan-3-ol.
| Compound Name | (2R,3S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methyloxan-3-ol |
|---|---|
| PubChem CID | 10874560 |
| Molecular Formula | C28H40O5Si |
| Molecular Weight | 484.71 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | (2R,3S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methyloxan-3-ol |
| SMILES | CC1(C)OC[C@H]([C@]2(C)CC[C@H](O)[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)O1 |
| InChI | InChI=1S/C28H40O5Si/c1-26(2,3)34(21-13-9-7-10-14-21,22-15-11-8-12-16-22)31-19-24-23(29)17-18-28(6,32-24)25-20-30-27(4,5)33-25/h7-16,23-25,29H,17-20H2,1-6H3/t23-,24+,25+,28-/m0/s1 |
| InChIKey | APPHUBLSZLRPBX-FQJHJXCSSA-N |
| XLogP | 4.01 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.71 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|