C27H40O4Si — CID 11167004
(1S)-1-[(2R,4S,5S)-4-[tert-butyl(diphenyl)silyl]oxy-5-pentyloxolan-2-yl]ethane-1,2-diol (PubChem CID 11167004) has the molecular formula C27H40O4Si and a molecular weight of 456.70 g/mol. Its IUPAC name is (1S)-1-[(2R,4S,5S)-4-[tert-butyl(diphenyl)silyl]oxy-5-pentyloxolan-2-yl]ethane-1,2-diol.
| Compound Name | (1S)-1-[(2R,4S,5S)-4-[tert-butyl(diphenyl)silyl]oxy-5-pentyloxolan-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 11167004 |
| Molecular Formula | C27H40O4Si |
| Molecular Weight | 456.70 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | (1S)-1-[(2R,4S,5S)-4-[tert-butyl(diphenyl)silyl]oxy-5-pentyloxolan-2-yl]ethane-1,2-diol |
| SMILES | CCCCC[C@@H]1O[C@@H]([C@@H](O)CO)C[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H40O4Si/c1-5-6-9-18-24-26(19-25(30-24)23(29)20-28)31-32(27(2,3)4,21-14-10-7-11-15-21)22-16-12-8-13-17-22/h7-8,10-17,23-26,28-29H,5-6,9,18-20H2,1-4H3/t23-,24-,25+,26-/m0/s1 |
| InChIKey | AFWANYUHCUIAIY-SSUZURRFSA-N |
| XLogP | 4.02 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.70 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|