C23H32O4Si — CID 10408712
[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (PubChem CID 10408712) has the molecular formula C23H32O4Si and a molecular weight of 400.59 g/mol. Its IUPAC name is [(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 10408712 |
| Molecular Formula | C23H32O4Si |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | [(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| SMILES | CC1(C)O[C@@H](CO)[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C23H32O4Si/c1-22(2,3)28(18-12-8-6-9-13-18,19-14-10-7-11-15-19)25-17-21-20(16-24)26-23(4,5)27-21/h6-15,20-21,24H,16-17H2,1-5H3/t20-,21-/m0/s1 |
| InChIKey | XMXUBCUCCBZXQX-SFTDATJTSA-N |
| XLogP | 3.08 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|