C27H38O3Si — CID 11305198
tert-butyl-[(2S,3S,5R)-5-[(2R)-oxiran-2-yl]-2-pentyloxolan-3-yl]oxy-diphenylsilane (PubChem CID 11305198) has the molecular formula C27H38O3Si and a molecular weight of 438.68 g/mol. Its IUPAC name is tert-butyl-[(2S,3S,5R)-5-[(2R)-oxiran-2-yl]-2-pentyloxolan-3-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2S,3S,5R)-5-[(2R)-oxiran-2-yl]-2-pentyloxolan-3-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 11305198 |
| Molecular Formula | C27H38O3Si |
| Molecular Weight | 438.68 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | tert-butyl-[(2S,3S,5R)-5-[(2R)-oxiran-2-yl]-2-pentyloxolan-3-yl]oxy-diphenylsilane |
| SMILES | CCCCC[C@@H]1O[C@@H]([C@H]2CO2)C[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H38O3Si/c1-5-6-9-18-23-25(19-24(29-23)26-20-28-26)30-31(27(2,3)4,21-14-10-7-11-15-21)22-16-12-8-13-17-22/h7-8,10-17,23-26H,5-6,9,18-20H2,1-4H3/t23-,24+,25-,26+/m0/s1 |
| InChIKey | XLUQHBCPVPIORU-ROXDYWFKSA-N |
| XLogP | 5.07 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.68 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|