C33H50O4Si — CID 10721159
(3R)-3-[(4R,5R,6S)-6-[(3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pentyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]butan-2-one (PubChem CID 10721159) has the molecular formula C33H50O4Si and a molecular weight of 538.85 g/mol. Its IUPAC name is (3R)-3-[(4R,5R,6S)-6-[(3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pentyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]butan-2-one.
| Compound Name | (3R)-3-[(4R,5R,6S)-6-[(3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pentyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]butan-2-one |
|---|---|
| PubChem CID | 10721159 |
| Molecular Formula | C33H50O4Si |
| Molecular Weight | 538.85 g/mol |
| Exact Mass | 538.35 |
| IUPAC Name | (3R)-3-[(4R,5R,6S)-6-[(3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pentyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]butan-2-one |
| SMILES | CCC(CC[C@@H]1OC(C)(C)O[C@@H]([C@@H](C)C(C)=O)[C@@H]1C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H50O4Si/c1-10-27(21-22-30-25(3)31(24(2)26(4)34)37-33(8,9)36-30)23-35-38(32(5,6)7,28-17-13-11-14-18-28)29-19-15-12-16-20-29/h11-20,24-25,27,30-31H,10,21-23H2,1-9H3/t24-,25+,27?,30-,31-/m0/s1 |
| InChIKey | CVPUHXSHWSZZPR-MMILIOPZSA-N |
| XLogP | 6.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.85 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|