C29H40O5Si — CID 11785259
[(2R,3R,4S,5S,6R)-2-acetyl-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,5-dimethyloxan-4-yl] acetate (PubChem CID 11785259) has the molecular formula C29H40O5Si and a molecular weight of 496.72 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-2-acetyl-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,5-dimethyloxan-4-yl] acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-2-acetyl-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,5-dimethyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 11785259 |
| Molecular Formula | C29H40O5Si |
| Molecular Weight | 496.72 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-2-acetyl-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,5-dimethyloxan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](C)[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H](C(C)=O)[C@@H]1C |
| InChI | InChI=1S/C29H40O5Si/c1-20-26(34-28(22(3)30)21(2)27(20)33-23(4)31)18-19-32-35(29(5,6)7,24-14-10-8-11-15-24)25-16-12-9-13-17-25/h8-17,20-21,26-28H,18-19H2,1-7H3/t20-,21+,26+,27-,28+/m0/s1 |
| InChIKey | KOQYGHAMSDFBTD-ZJGHCBKXSA-N |
| XLogP | 4.51 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.72 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|