C30H42O3Si — CID 23630450
ethyl 2-[(1R,5S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-5-methylcyclohex-2-en-1-yl]acetate (PubChem CID 23630450) has the molecular formula C30H42O3Si and a molecular weight of 478.75 g/mol. Its IUPAC name is ethyl 2-[(1R,5S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-5-methylcyclohex-2-en-1-yl]acetate.
| Compound Name | ethyl 2-[(1R,5S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-5-methylcyclohex-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 23630450 |
| Molecular Formula | C30H42O3Si |
| Molecular Weight | 478.75 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | ethyl 2-[(1R,5S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-5-methylcyclohex-2-en-1-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1C[C@@H](C)CC=C1CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H42O3Si/c1-6-32-29(31)23-26-22-24(2)19-20-25(26)14-13-21-33-34(30(3,4)5,27-15-9-7-10-16-27)28-17-11-8-12-18-28/h7-12,15-18,20,24,26H,6,13-14,19,21-23H2,1-5H3/t24-,26+/m0/s1 |
| InChIKey | ZMAIFIOOFAEXNT-AZGAKELHSA-N |
| XLogP | 6.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.75 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|