C34H42O3Si — CID 11466657
(2R,3R,6S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-2-(2-phenylethyl)-6-prop-2-enyloxan-4-one (PubChem CID 11466657) has the molecular formula C34H42O3Si and a molecular weight of 526.79 g/mol. Its IUPAC name is (2R,3R,6S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-2-(2-phenylethyl)-6-prop-2-enyloxan-4-one.
| Compound Name | (2R,3R,6S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-2-(2-phenylethyl)-6-prop-2-enyloxan-4-one |
|---|---|
| PubChem CID | 11466657 |
| Molecular Formula | C34H42O3Si |
| Molecular Weight | 526.79 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | (2R,3R,6S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-2-(2-phenylethyl)-6-prop-2-enyloxan-4-one |
| SMILES | C=CC[C@H]1CC(=O)[C@](C)(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](CCc2ccccc2)O1 |
| InChI | InChI=1S/C34H42O3Si/c1-6-16-28-25-31(35)34(5,32(37-28)24-23-27-17-10-7-11-18-27)26-36-38(33(2,3)4,29-19-12-8-13-20-29)30-21-14-9-15-22-30/h6-15,17-22,28,32H,1,16,23-26H2,2-5H3/t28-,32+,34-/m0/s1 |
| InChIKey | VUZZHHAUVWYVFY-OKRUAUFTSA-N |
| XLogP | 6.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.79 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|