C36H52O7SSi — CID 12003201
[(2S,4S,6S)-6-[(2R)-2-[tert-butyl(diphenyl)silyl]oxy-4-tert-butylsulfanyl-4-oxobutyl]-2-methoxy-3,3-dimethyl-2-(2-oxoethyl)oxan-4-yl] acetate (PubChem CID 12003201) has the molecular formula C36H52O7SSi and a molecular weight of 656.96 g/mol. Its IUPAC name is [(2S,4S,6S)-6-[(2R)-2-[tert-butyl(diphenyl)silyl]oxy-4-tert-butylsulfanyl-4-oxobutyl]-2-methoxy-3,3-dimethyl-2-(2-oxoethyl)oxan-4-yl] acetate.
| Compound Name | [(2S,4S,6S)-6-[(2R)-2-[tert-butyl(diphenyl)silyl]oxy-4-tert-butylsulfanyl-4-oxobutyl]-2-methoxy-3,3-dimethyl-2-(2-oxoethyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 12003201 |
| Molecular Formula | C36H52O7SSi |
| Molecular Weight | 656.96 g/mol |
| Exact Mass | 656.32 |
| IUPAC Name | [(2S,4S,6S)-6-[(2R)-2-[tert-butyl(diphenyl)silyl]oxy-4-tert-butylsulfanyl-4-oxobutyl]-2-methoxy-3,3-dimethyl-2-(2-oxoethyl)oxan-4-yl] acetate |
| SMILES | CO[C@@]1(CC=O)O[C@H](C[C@H](CC(=O)SC(C)(C)C)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@H](OC(C)=O)C1(C)C |
| InChI | InChI=1S/C36H52O7SSi/c1-26(38)41-31-24-27(42-36(40-10,21-22-37)35(31,8)9)23-28(25-32(39)44-33(2,3)4)43-45(34(5,6)7,29-17-13-11-14-18-29)30-19-15-12-16-20-30/h11-20,22,27-28,31H,21,23-25H2,1-10H3/t27-,28-,31+,36+/m1/s1 |
| InChIKey | KWSTVVFWSPFZKR-WVXIGILYSA-N |
| XLogP | 6.45 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.96 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|