C42H68O6SSi2 — CID 12003199
[(3R,5S,7S)-11-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxy-1-tert-butylsulfanyl-5-hydroxy-8,8-dimethyl-9-methylidene-1-oxoundecan-7-yl] acetate (PubChem CID 12003199) has the molecular formula C42H68O6SSi2 and a molecular weight of 757.24 g/mol. Its IUPAC name is [(3R,5S,7S)-11-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxy-1-tert-butylsulfanyl-5-hydroxy-8,8-dimethyl-9-methylidene-1-oxoundecan-7-yl] acetate.
| Compound Name | [(3R,5S,7S)-11-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxy-1-tert-butylsulfanyl-5-hydroxy-8,8-dimethyl-9-methylidene-1-oxoundecan-7-yl] acetate |
|---|---|
| PubChem CID | 12003199 |
| Molecular Formula | C42H68O6SSi2 |
| Molecular Weight | 757.24 g/mol |
| Exact Mass | 756.43 |
| IUPAC Name | [(3R,5S,7S)-11-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxy-1-tert-butylsulfanyl-5-hydroxy-8,8-dimethyl-9-methylidene-1-oxoundecan-7-yl] acetate |
| SMILES | C=C(CCO[Si](C)(C)C(C)(C)C)C(C)(C)[C@H](C[C@H](O)C[C@H](CC(=O)SC(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C42H68O6SSi2/c1-31(26-27-46-50(14,15)40(6,7)8)42(12,13)37(47-32(2)43)29-33(44)28-34(30-38(45)49-39(3,4)5)48-51(41(9,10)11,35-22-18-16-19-23-35)36-24-20-17-21-25-36/h16-25,33-34,37,44H,1,26-30H2,2-15H3/t33-,34-,37+/m1/s1 |
| InChIKey | DKMCDDNBZKPJAJ-ZDNUIVDRSA-N |
| XLogP | 9.45 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.24 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|