C22H38O4Si — CID 134970321
ethyl (3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-8-phenyloctanoate (PubChem CID 134970321) has the molecular formula C22H38O4Si and a molecular weight of 394.63 g/mol. Its IUPAC name is ethyl (3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-8-phenyloctanoate.
| Compound Name | ethyl (3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-8-phenyloctanoate |
|---|---|
| PubChem CID | 134970321 |
| Molecular Formula | C22H38O4Si |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | ethyl (3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-8-phenyloctanoate |
| SMILES | CCOC(=O)C[C@H](O)C[C@@H](CCCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H38O4Si/c1-7-25-21(24)17-19(23)16-20(26-27(5,6)22(2,3)4)15-11-14-18-12-9-8-10-13-18/h8-10,12-13,19-20,23H,7,11,14-17H2,1-6H3/t19-,20-/m1/s1 |
| InChIKey | DAKCUBADARUYFV-WOJBJXKFSA-N |
| XLogP | 5.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|