C24H40O7Si — CID 134837500
methyl 2-[(4R,5R,6R)-6-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-2-phenylethyl]-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]acetate (PubChem CID 134837500) has the molecular formula C24H40O7Si and a molecular weight of 468.66 g/mol. Its IUPAC name is methyl 2-[(4R,5R,6R)-6-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-2-phenylethyl]-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]acetate.
| Compound Name | methyl 2-[(4R,5R,6R)-6-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-2-phenylethyl]-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 134837500 |
| Molecular Formula | C24H40O7Si |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | methyl 2-[(4R,5R,6R)-6-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-2-phenylethyl]-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| SMILES | COC(=O)C[C@H]1OC(C)(C)O[C@@H]([C@@H](OC)[C@H](O[Si](C)(C)C(C)(C)C)c2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C24H40O7Si/c1-23(2,3)32(8,9)31-20(16-13-11-10-12-14-16)22(28-7)21-19(26)17(15-18(25)27-6)29-24(4,5)30-21/h10-14,17,19-22,26H,15H2,1-9H3/t17-,19-,20-,21-,22+/m1/s1 |
| InChIKey | DTLWUYYGVJPFJE-FYKMYLNBSA-N |
| XLogP | 4.21 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|