C28H42O7 — CID 72725084
(1R,2S,5S,10S,12E,14S,15S,16S,17S,18R)-1,17-dihydroxy-10,18-dimethoxy-2,14,16-trimethyl-5-phenyl-4,19-dioxabicyclo[13.3.1]nonadec-12-en-3-one (PubChem CID 72725084) has the molecular formula C28H42O7 and a molecular weight of 490.64 g/mol. Its IUPAC name is (1R,2S,5S,10S,12E,14S,15S,16S,17S,18R)-1,17-dihydroxy-10,18-dimethoxy-2,14,16-trimethyl-5-phenyl-4,19-dioxabicyclo[13.3.1]nonadec-12-en-3-one.
| Compound Name | (1R,2S,5S,10S,12E,14S,15S,16S,17S,18R)-1,17-dihydroxy-10,18-dimethoxy-2,14,16-trimethyl-5-phenyl-4,19-dioxabicyclo[13.3.1]nonadec-12-en-3-one |
|---|---|
| PubChem CID | 72725084 |
| Molecular Formula | C28H42O7 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | (1R,2S,5S,10S,12E,14S,15S,16S,17S,18R)-1,17-dihydroxy-10,18-dimethoxy-2,14,16-trimethyl-5-phenyl-4,19-dioxabicyclo[13.3.1]nonadec-12-en-3-one |
| SMILES | CO[C@@H]1C/C=C/[C@H](C)[C@@H]2O[C@](O)([C@H](C)C(=O)O[C@H](c3ccccc3)CCCC1)[C@H](OC)[C@@H](O)[C@@H]2C |
| InChI | InChI=1S/C28H42O7/c1-18-12-11-16-22(32-4)15-9-10-17-23(21-13-7-6-8-14-21)34-27(30)20(3)28(31)26(33-5)24(29)19(2)25(18)35-28/h6-8,11-14,18-20,22-26,29,31H,9-10,15-17H2,1-5H3/b12-11+/t18-,19-,20+,22-,23-,24-,25-,26+,28+/m0/s1 |
| InChIKey | UMCKSSJPMPCENN-GNRFJFGXSA-N |
| XLogP | 4.18 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|