C39H56O4Si — CID 14864914
(2R,3S,6S,8R,10S)-2-[(2S)-butan-2-yl]-8-[(2E,4S,5S)-4-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethylhepta-2,6-dienyl]-3-methyl-1,7-dioxaspiro[5.5]undec-4-en-10-ol (PubChem CID 14864914) has the molecular formula C39H56O4Si and a molecular weight of 616.96 g/mol. Its IUPAC name is (2R,3S,6S,8R,10S)-2-[(2S)-butan-2-yl]-8-[(2E,4S,5S)-4-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethylhepta-2,6-dienyl]-3-methyl-1,7-dioxaspiro[5.5]undec-4-en-10-ol.
| Compound Name | (2R,3S,6S,8R,10S)-2-[(2S)-butan-2-yl]-8-[(2E,4S,5S)-4-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethylhepta-2,6-dienyl]-3-methyl-1,7-dioxaspiro[5.5]undec-4-en-10-ol |
|---|---|
| PubChem CID | 14864914 |
| Molecular Formula | C39H56O4Si |
| Molecular Weight | 616.96 g/mol |
| Exact Mass | 616.39 |
| IUPAC Name | (2R,3S,6S,8R,10S)-2-[(2S)-butan-2-yl]-8-[(2E,4S,5S)-4-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethylhepta-2,6-dienyl]-3-methyl-1,7-dioxaspiro[5.5]undec-4-en-10-ol |
| SMILES | C=C[C@H](C)[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)/C(C)=C/C[C@@H]1C[C@H](O)C[C@]2(C=C[C@H](C)[C@@H]([C@@H](C)CC)O2)O1 |
| InChI | InChI=1S/C39H56O4Si/c1-10-28(3)36-31(6)24-25-39(42-36)27-32(40)26-33(41-39)23-22-30(5)37(29(4)11-2)43-44(38(7,8)9,34-18-14-12-15-19-34)35-20-16-13-17-21-35/h11-22,24-25,28-29,31-33,36-37,40H,2,10,23,26-27H2,1,3-9H3/b30-22+/t28-,29-,31-,32-,33+,36+,37-,39+/m0/s1 |
| InChIKey | LDWVXIZEKQXJDM-UKEOZXNJSA-N |
| XLogP | 7.96 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.96 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|