C32H56O7Si — CID 11169183
(1R)-1-[(4R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-[(4R,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]propan-1-ol (PubChem CID 11169183) has the molecular formula C32H56O7Si and a molecular weight of 580.88 g/mol. Its IUPAC name is (1R)-1-[(4R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-[(4R,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]propan-1-ol.
| Compound Name | (1R)-1-[(4R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-[(4R,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 11169183 |
| Molecular Formula | C32H56O7Si |
| Molecular Weight | 580.88 g/mol |
| Exact Mass | 580.38 |
| IUPAC Name | (1R)-1-[(4R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-[(4R,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]propan-1-ol |
| SMILES | CC1(C)O[C@H](CC[C@@H](O)[C@H]2C[C@@H](CCO[Si](C)(C)C(C)(C)C)OC(C)(C)O2)C[C@H](CCOCc2ccccc2)O1 |
| InChI | InChI=1S/C32H56O7Si/c1-30(2,3)40(8,9)35-20-18-27-22-29(39-32(6,7)38-27)28(33)16-15-25-21-26(37-31(4,5)36-25)17-19-34-23-24-13-11-10-12-14-24/h10-14,25-29,33H,15-23H2,1-9H3/t25-,26+,27-,28-,29-/m1/s1 |
| InChIKey | MXFUXNPSTLJKFK-FUIJPYTFSA-N |
| XLogP | 6.97 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.88 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|