C33H46O4Si2 — CID 10816744
tert-butyl-[(2R,3R,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(E)-5-trimethylsilylpent-2-en-4-ynyl]oxolan-3-yl]oxy-diphenylsilane (PubChem CID 10816744) has the molecular formula C33H46O4Si2 and a molecular weight of 562.90 g/mol. Its IUPAC name is tert-butyl-[(2R,3R,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(E)-5-trimethylsilylpent-2-en-4-ynyl]oxolan-3-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2R,3R,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(E)-5-trimethylsilylpent-2-en-4-ynyl]oxolan-3-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 10816744 |
| Molecular Formula | C33H46O4Si2 |
| Molecular Weight | 562.90 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | tert-butyl-[(2R,3R,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(E)-5-trimethylsilylpent-2-en-4-ynyl]oxolan-3-yl]oxy-diphenylsilane |
| SMILES | CC1(C)OC[C@@H]([C@H]2C[C@@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H](C/C=C/C#C[Si](C)(C)C)O2)O1 |
| InChI | InChI=1S/C33H46O4Si2/c1-32(2,3)39(26-18-12-9-13-19-26,27-20-14-10-15-21-27)37-30-24-29(31-25-34-33(4,5)36-31)35-28(30)22-16-11-17-23-38(6,7)8/h9-16,18-21,28-31H,22,24-25H2,1-8H3/b16-11+/t28-,29-,30-,31+/m1/s1 |
| InChIKey | BTZUOHBEHKCZIU-FSIHBDPLSA-N |
| XLogP | 6.07 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.90 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|