C29H40O5Si — CID 101419414
tert-butyl-[2-[2-[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]-1,3-dioxolan-2-yl]ethoxy]-diphenylsilane (PubChem CID 101419414) has the molecular formula C29H40O5Si and a molecular weight of 496.72 g/mol. Its IUPAC name is tert-butyl-[2-[2-[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]-1,3-dioxolan-2-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[2-[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]-1,3-dioxolan-2-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 101419414 |
| Molecular Formula | C29H40O5Si |
| Molecular Weight | 496.72 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | tert-butyl-[2-[2-[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]-1,3-dioxolan-2-yl]ethoxy]-diphenylsilane |
| SMILES | CC1(C)OC[C@H](/C=C/CC2(CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)OCCO2)O1 |
| InChI | InChI=1S/C29H40O5Si/c1-27(2,3)35(25-14-8-6-9-15-25,26-16-10-7-11-17-26)33-20-19-29(30-21-22-31-29)18-12-13-24-23-32-28(4,5)34-24/h6-17,24H,18-23H2,1-5H3/b13-12+/t24-/m0/s1 |
| InChIKey | REIKBAVEUJIVAA-BYUVYSIJSA-N |
| XLogP | 4.79 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.72 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|