C41H66O5Si — CID 58713414
(2R,3S)-5-[tert-butyl(diphenyl)silyl]oxy-3-ethyl-2-[(E)-8-(2-heptyl-1,3-dioxolan-2-yl)oct-1-enyl]pentane-1,3-diol (PubChem CID 58713414) has the molecular formula C41H66O5Si and a molecular weight of 667.06 g/mol. Its IUPAC name is (2R,3S)-5-[tert-butyl(diphenyl)silyl]oxy-3-ethyl-2-[(E)-8-(2-heptyl-1,3-dioxolan-2-yl)oct-1-enyl]pentane-1,3-diol.
| Compound Name | (2R,3S)-5-[tert-butyl(diphenyl)silyl]oxy-3-ethyl-2-[(E)-8-(2-heptyl-1,3-dioxolan-2-yl)oct-1-enyl]pentane-1,3-diol |
|---|---|
| PubChem CID | 58713414 |
| Molecular Formula | C41H66O5Si |
| Molecular Weight | 667.06 g/mol |
| Exact Mass | 666.47 |
| IUPAC Name | (2R,3S)-5-[tert-butyl(diphenyl)silyl]oxy-3-ethyl-2-[(E)-8-(2-heptyl-1,3-dioxolan-2-yl)oct-1-enyl]pentane-1,3-diol |
| SMILES | CCCCCCCC1(CCCCCC/C=C/[C@H](CO)[C@](O)(CC)CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OCCO1 |
| InChI | InChI=1S/C41H66O5Si/c1-6-8-9-13-22-29-41(44-33-34-45-41)30-23-14-11-10-12-17-24-36(35-42)40(43,7-2)31-32-46-47(39(3,4)5,37-25-18-15-19-26-37)38-27-20-16-21-28-38/h15-21,24-28,36,42-43H,6-14,22-23,29-35H2,1-5H3/b24-17+/t36-,40+/m1/s1 |
| InChIKey | VNMDDRTWEQWSRF-JOQKBZGQSA-N |
| XLogP | 8.70 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.06 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|