C43H70O6Si — CID 70857467
(E,4S)-1-[tert-butyl(diphenyl)silyl]oxy-3-ethyl-12-(2-heptyl-1,3-dioxolan-2-yl)-3-(2-hydroxypropan-2-yloxy)dodec-5-en-4-ol (PubChem CID 70857467) has the molecular formula C43H70O6Si and a molecular weight of 711.11 g/mol. Its IUPAC name is (E,4S)-1-[tert-butyl(diphenyl)silyl]oxy-3-ethyl-12-(2-heptyl-1,3-dioxolan-2-yl)-3-(2-hydroxypropan-2-yloxy)dodec-5-en-4-ol.
| Compound Name | (E,4S)-1-[tert-butyl(diphenyl)silyl]oxy-3-ethyl-12-(2-heptyl-1,3-dioxolan-2-yl)-3-(2-hydroxypropan-2-yloxy)dodec-5-en-4-ol |
|---|---|
| PubChem CID | 70857467 |
| Molecular Formula | C43H70O6Si |
| Molecular Weight | 711.11 g/mol |
| Exact Mass | 710.49 |
| IUPAC Name | (E,4S)-1-[tert-butyl(diphenyl)silyl]oxy-3-ethyl-12-(2-heptyl-1,3-dioxolan-2-yl)-3-(2-hydroxypropan-2-yloxy)dodec-5-en-4-ol |
| SMILES | CCCCCCCC1(CCCCCC/C=C/[C@H](O)C(CC)(CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(C)(C)O)OCCO1 |
| InChI | InChI=1S/C43H70O6Si/c1-8-10-11-15-24-31-43(46-35-36-47-43)32-25-16-13-12-14-23-30-39(44)42(9-2,49-41(6,7)45)33-34-48-50(40(3,4)5,37-26-19-17-20-27-37)38-28-21-18-22-29-38/h17-23,26-30,39,44-45H,8-16,24-25,31-36H2,1-7H3/b30-23+/t39-,42?/m0/s1 |
| InChIKey | IQMPFXXHWRENFW-PBBBZYPBSA-N |
| XLogP | 9.21 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.11 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|