C26H38O2Si — CID 56652865
(E)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]non-3-en-2-ol (PubChem CID 56652865) has the molecular formula C26H38O2Si and a molecular weight of 410.67 g/mol. Its IUPAC name is (E)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]non-3-en-2-ol.
| Compound Name | (E)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]non-3-en-2-ol |
|---|---|
| PubChem CID | 56652865 |
| Molecular Formula | C26H38O2Si |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | (E)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]non-3-en-2-ol |
| SMILES | CCCCC/C=C(\CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)O |
| InChI | InChI=1S/C26H38O2Si/c1-6-7-8-11-16-23(22(2)27)21-28-29(26(3,4)5,24-17-12-9-13-18-24)25-19-14-10-15-20-25/h9-10,12-20,22,27H,6-8,11,21H2,1-5H3/b23-16+ |
| InChIKey | OGHWWCKGLYNTHB-XQNSMLJCSA-N |
| XLogP | 5.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|