C30H38O2Si — CID 56653219
(E)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,4-dimethyl-1-phenylpent-1-en-3-ol (PubChem CID 56653219) has the molecular formula C30H38O2Si and a molecular weight of 458.72 g/mol. Its IUPAC name is (E)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,4-dimethyl-1-phenylpent-1-en-3-ol.
| Compound Name | (E)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,4-dimethyl-1-phenylpent-1-en-3-ol |
|---|---|
| PubChem CID | 56653219 |
| Molecular Formula | C30H38O2Si |
| Molecular Weight | 458.72 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | (E)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,4-dimethyl-1-phenylpent-1-en-3-ol |
| SMILES | CC(C)(C)C(O)/C(=C/c1ccccc1)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H38O2Si/c1-29(2,3)28(31)25(22-24-16-10-7-11-17-24)23-32-33(30(4,5)6,26-18-12-8-13-19-26)27-20-14-9-15-21-27/h7-22,28,31H,23H2,1-6H3/b25-22+ |
| InChIKey | LOCWQONJZUDQOX-YYDJUVGSSA-N |
| XLogP | 6.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.72 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|