C29H35ClO2Si — CID 101480551
(Z,1R)-5-[tert-butyl(diphenyl)silyl]oxy-1-(4-chlorophenyl)-2-ethylpent-2-en-1-ol (PubChem CID 101480551) has the molecular formula C29H35ClO2Si and a molecular weight of 479.14 g/mol. Its IUPAC name is (Z,1R)-5-[tert-butyl(diphenyl)silyl]oxy-1-(4-chlorophenyl)-2-ethylpent-2-en-1-ol.
| Compound Name | (Z,1R)-5-[tert-butyl(diphenyl)silyl]oxy-1-(4-chlorophenyl)-2-ethylpent-2-en-1-ol |
|---|---|
| PubChem CID | 101480551 |
| Molecular Formula | C29H35ClO2Si |
| Molecular Weight | 479.14 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | (Z,1R)-5-[tert-butyl(diphenyl)silyl]oxy-1-(4-chlorophenyl)-2-ethylpent-2-en-1-ol |
| SMILES | CC/C(=C/CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H35ClO2Si/c1-5-23(28(31)24-18-20-25(30)21-19-24)13-12-22-32-33(29(2,3)4,26-14-8-6-9-15-26)27-16-10-7-11-17-27/h6-11,13-21,28,31H,5,12,22H2,1-4H3/b23-13-/t28-/m1/s1 |
| InChIKey | HQMFHWCRPZLSDZ-QMSKISIRSA-N |
| XLogP | 6.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.14 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|