C29H46O3Si2 — CID 102257239
(E,2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxyhept-4-en-3-ol (PubChem CID 102257239) has the molecular formula C29H46O3Si2 and a molecular weight of 498.86 g/mol. Its IUPAC name is (E,2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxyhept-4-en-3-ol.
| Compound Name | (E,2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxyhept-4-en-3-ol |
|---|---|
| PubChem CID | 102257239 |
| Molecular Formula | C29H46O3Si2 |
| Molecular Weight | 498.86 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | (E,2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxyhept-4-en-3-ol |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)/C=C/CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H46O3Si2/c1-24(32-33(8,9)28(2,3)4)27(30)22-16-17-23-31-34(29(5,6)7,25-18-12-10-13-19-25)26-20-14-11-15-21-26/h10-16,18-22,24,27,30H,17,23H2,1-9H3/b22-16+/t24-,27-/m0/s1 |
| InChIKey | TXPAESHHSQUKKR-XMCWSZHLSA-N |
| XLogP | 6.28 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.86 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|