C25H35NO2Si2 — CID 101163169
(E)-6-[tert-butyl(diphenyl)silyl]oxy-2-trimethylsilyloxyhex-3-enenitrile (PubChem CID 101163169) has the molecular formula C25H35NO2Si2 and a molecular weight of 437.73 g/mol. Its IUPAC name is (E)-6-[tert-butyl(diphenyl)silyl]oxy-2-trimethylsilyloxyhex-3-enenitrile.
| Compound Name | (E)-6-[tert-butyl(diphenyl)silyl]oxy-2-trimethylsilyloxyhex-3-enenitrile |
|---|---|
| PubChem CID | 101163169 |
| Molecular Formula | C25H35NO2Si2 |
| Molecular Weight | 437.73 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | (E)-6-[tert-butyl(diphenyl)silyl]oxy-2-trimethylsilyloxyhex-3-enenitrile |
| SMILES | CC(C)(C)[Si](OCC/C=C/C(C#N)O[Si](C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H35NO2Si2/c1-25(2,3)30(23-16-9-7-10-17-23,24-18-11-8-12-19-24)27-20-14-13-15-22(21-26)28-29(4,5)6/h7-13,15-19,22H,14,20H2,1-6H3/b15-13+ |
| InChIKey | NBACFGOOLHDXES-FYWRMAATSA-N |
| XLogP | 5.25 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.73 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|