C29H45NO2SSi — CID 174082233
tert-butyl-[[(E,4S)-8-[tert-butyl(diphenyl)silyl]oxy-2-methyloct-5-en-4-yl]amino]-oxidosulfanium (PubChem CID 174082233) has the molecular formula C29H45NO2SSi and a molecular weight of 499.84 g/mol. Its IUPAC name is tert-butyl-[[(E,4S)-8-[tert-butyl(diphenyl)silyl]oxy-2-methyloct-5-en-4-yl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(E,4S)-8-[tert-butyl(diphenyl)silyl]oxy-2-methyloct-5-en-4-yl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 174082233 |
| Molecular Formula | C29H45NO2SSi |
| Molecular Weight | 499.84 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | tert-butyl-[[(E,4S)-8-[tert-butyl(diphenyl)silyl]oxy-2-methyloct-5-en-4-yl]amino]-oxidosulfanium |
| SMILES | CC(C)C[C@@H](/C=C/CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N[S+]([O-])C(C)(C)C |
| InChI | InChI=1S/C29H45NO2SSi/c1-24(2)23-25(30-33(31)28(3,4)5)17-15-16-22-32-34(29(6,7)8,26-18-11-9-12-19-26)27-20-13-10-14-21-27/h9-15,17-21,24-25,30H,16,22-23H2,1-8H3/b17-15+/t25-,33?/m1/s1 |
| InChIKey | GBDZWRBCYKAYJG-AYRLCHMMSA-N |
| XLogP | 5.98 |
| TPSA | 44.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.84 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|