C26H36N2O2SSi — CID 175564004
tert-butyl-[[2-[tert-butyl(diphenyl)silyl]oxy-1-(1-cyanocyclopropyl)ethyl]amino]-oxidosulfanium (PubChem CID 175564004) has the molecular formula C26H36N2O2SSi and a molecular weight of 468.74 g/mol. Its IUPAC name is tert-butyl-[[2-[tert-butyl(diphenyl)silyl]oxy-1-(1-cyanocyclopropyl)ethyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[2-[tert-butyl(diphenyl)silyl]oxy-1-(1-cyanocyclopropyl)ethyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175564004 |
| Molecular Formula | C26H36N2O2SSi |
| Molecular Weight | 468.74 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | tert-butyl-[[2-[tert-butyl(diphenyl)silyl]oxy-1-(1-cyanocyclopropyl)ethyl]amino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])NC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C1(C#N)CC1 |
| InChI | InChI=1S/C26H36N2O2SSi/c1-24(2,3)31(29)28-23(26(20-27)17-18-26)19-30-32(25(4,5)6,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,23,28H,17-19H2,1-6H3 |
| InChIKey | WKSLZEZQHGLLLV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.74 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|