C30H33N5OSi — CID 101036757
(3S)-1-[(2R)-1-[tert-butyl(diphenyl)silyl]oxy-3-methylbutan-2-yl]-1-azaspiro[2.3]hexane-4,4,5,5-tetracarbonitrile (PubChem CID 101036757) has the molecular formula C30H33N5OSi and a molecular weight of 507.71 g/mol. Its IUPAC name is (3S)-1-[(2R)-1-[tert-butyl(diphenyl)silyl]oxy-3-methylbutan-2-yl]-1-azaspiro[2.3]hexane-4,4,5,5-tetracarbonitrile.
| Compound Name | (3S)-1-[(2R)-1-[tert-butyl(diphenyl)silyl]oxy-3-methylbutan-2-yl]-1-azaspiro[2.3]hexane-4,4,5,5-tetracarbonitrile |
|---|---|
| PubChem CID | 101036757 |
| Molecular Formula | C30H33N5OSi |
| Molecular Weight | 507.71 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | (3S)-1-[(2R)-1-[tert-butyl(diphenyl)silyl]oxy-3-methylbutan-2-yl]-1-azaspiro[2.3]hexane-4,4,5,5-tetracarbonitrile |
| SMILES | CC(C)[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N1C[C@@]12CC(C#N)(C#N)C2(C#N)C#N |
| InChI | InChI=1S/C30H33N5OSi/c1-23(2)26(35-22-30(35)17-28(18-31,19-32)29(30,20-33)21-34)16-36-37(27(3,4)5,24-12-8-6-9-13-24)25-14-10-7-11-15-25/h6-15,23,26H,16-17,22H2,1-5H3/t26-,30+,35?/m0/s1 |
| InChIKey | YKGCDYKHKQWYMG-VSFLKDGBSA-N |
| XLogP | 4.11 |
| TPSA | 107.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.71 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|