C25H34FNO2Si — CID 174058629
N-[2-[tert-butyl(diphenyl)silyl]oxy-1-(1-fluorocyclopropyl)ethyl]oxolan-3-amine (PubChem CID 174058629) has the molecular formula C25H34FNO2Si and a molecular weight of 427.64 g/mol. Its IUPAC name is N-[2-[tert-butyl(diphenyl)silyl]oxy-1-(1-fluorocyclopropyl)ethyl]oxolan-3-amine.
| Compound Name | N-[2-[tert-butyl(diphenyl)silyl]oxy-1-(1-fluorocyclopropyl)ethyl]oxolan-3-amine |
|---|---|
| PubChem CID | 174058629 |
| Molecular Formula | C25H34FNO2Si |
| Molecular Weight | 427.64 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | N-[2-[tert-butyl(diphenyl)silyl]oxy-1-(1-fluorocyclopropyl)ethyl]oxolan-3-amine |
| SMILES | CC(C)(C)[Si](OCC(NC1CCOC1)C1(F)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H34FNO2Si/c1-24(2,3)30(21-10-6-4-7-11-21,22-12-8-5-9-13-22)29-19-23(25(26)15-16-25)27-20-14-17-28-18-20/h4-13,20,23,27H,14-19H2,1-3H3 |
| InChIKey | IJNIYPCJNDOBGR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|