C21H30ClNO2Si — CID 131732786
tert-butyl-[[(3R)-morpholin-3-yl]methoxy]-diphenylsilane;hydrochloride (PubChem CID 131732786) has the molecular formula C21H30ClNO2Si and a molecular weight of 392.02 g/mol. Its IUPAC name is tert-butyl-[[(3R)-morpholin-3-yl]methoxy]-diphenylsilane;hydrochloride.
| Compound Name | tert-butyl-[[(3R)-morpholin-3-yl]methoxy]-diphenylsilane;hydrochloride |
|---|---|
| PubChem CID | 131732786 |
| Molecular Formula | C21H30ClNO2Si |
| Molecular Weight | 392.02 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | tert-butyl-[[(3R)-morpholin-3-yl]methoxy]-diphenylsilane;hydrochloride |
| SMILES | CC(C)(C)[Si](OC[C@H]1COCCN1)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C21H29NO2Si.ClH/c1-21(2,3)25(19-10-6-4-7-11-19,20-12-8-5-9-13-20)24-17-18-16-23-15-14-22-18;/h4-13,18,22H,14-17H2,1-3H3;1H/t18-;/m1./s1 |
| InChIKey | ZCQQXQQLBBRREN-GMUIIQOCSA-N |
| XLogP | 2.97 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.02 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|