C39H62O2Si2 — CID 11072197
tert-butyl-[(3E,6E,8E,12S)-14-[tert-butyl(dimethyl)silyl]oxy-4,6,12-trimethyltetradeca-3,6,8-trienoxy]-diphenylsilane (PubChem CID 11072197) has the molecular formula C39H62O2Si2 and a molecular weight of 619.10 g/mol. Its IUPAC name is tert-butyl-[(3E,6E,8E,12S)-14-[tert-butyl(dimethyl)silyl]oxy-4,6,12-trimethyltetradeca-3,6,8-trienoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(3E,6E,8E,12S)-14-[tert-butyl(dimethyl)silyl]oxy-4,6,12-trimethyltetradeca-3,6,8-trienoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11072197 |
| Molecular Formula | C39H62O2Si2 |
| Molecular Weight | 619.10 g/mol |
| Exact Mass | 618.43 |
| IUPAC Name | tert-butyl-[(3E,6E,8E,12S)-14-[tert-butyl(dimethyl)silyl]oxy-4,6,12-trimethyltetradeca-3,6,8-trienoxy]-diphenylsilane |
| SMILES | C/C(=C\C=C\CC[C@H](C)CCO[Si](C)(C)C(C)(C)C)C/C(C)=C/CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C39H62O2Si2/c1-33(29-31-40-42(10,11)38(4,5)6)22-15-12-16-23-34(2)32-35(3)24-21-30-41-43(39(7,8)9,36-25-17-13-18-26-36)37-27-19-14-20-28-37/h12-14,16-20,23-28,33H,15,21-22,29-32H2,1-11H3/b16-12+,34-23+,35-24+/t33-/m0/s1 |
| InChIKey | OLKGPKFQTPOXQN-YBFBFQJASA-N |
| XLogP | 10.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.10 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|