C31H44O2Si — CID 10504788
tert-butyl-[(4E,6E,10R)-10-methoxy-7-methyltrideca-4,6,12-trienoxy]-diphenylsilane (PubChem CID 10504788) has the molecular formula C31H44O2Si and a molecular weight of 476.78 g/mol. Its IUPAC name is tert-butyl-[(4E,6E,10R)-10-methoxy-7-methyltrideca-4,6,12-trienoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(4E,6E,10R)-10-methoxy-7-methyltrideca-4,6,12-trienoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10504788 |
| Molecular Formula | C31H44O2Si |
| Molecular Weight | 476.78 g/mol |
| Exact Mass | 476.31 |
| IUPAC Name | tert-butyl-[(4E,6E,10R)-10-methoxy-7-methyltrideca-4,6,12-trienoxy]-diphenylsilane |
| SMILES | C=CC[C@@H](CC/C(C)=C/C=C/CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC |
| InChI | InChI=1S/C31H44O2Si/c1-7-18-28(32-6)25-24-27(2)19-12-8-9-17-26-33-34(31(3,4)5,29-20-13-10-14-21-29)30-22-15-11-16-23-30/h7-8,10-16,19-23,28H,1,9,17-18,24-26H2,2-6H3/b12-8+,27-19+/t28-/m0/s1 |
| InChIKey | ZQQLBHCZALDSSZ-QHGJEMQUSA-N |
| XLogP | 7.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.78 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|